C14H19NO3 — CID 86724500
benzyl (2R)-5-hydroxy-2-methylpiperidine-1-carboxylate (PubChem CID 86724500) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is benzyl (2R)-5-hydroxy-2-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2R)-5-hydroxy-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86724500 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | benzyl (2R)-5-hydroxy-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CCC(O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-11-7-8-13(16)9-15(11)14(17)18-10-12-5-3-2-4-6-12/h2-6,11,13,16H,7-10H2,1H3/t11-,13?/m1/s1 |
| InChIKey | PORAIKBIDRNMQN-JTDNENJMSA-N |
| XLogP | 2.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |