C23H24F6N4O2 — CID 86724807
N-(2-amino-5,5,5-trifluoro-2-methylpentyl)-2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 86724807) has the molecular formula C23H24F6N4O2 and a molecular weight of 502.46 g/mol. Its IUPAC name is N-(2-amino-5,5,5-trifluoro-2-methylpentyl)-2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5,5,5-trifluoro-2-methylpentyl)-2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86724807 |
| Molecular Formula | C23H24F6N4O2 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-(2-amino-5,5,5-trifluoro-2-methylpentyl)-2,6-dimethyl-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1cc(OCc2c(F)ccc(F)c2F)c2nc(C)c(C(=O)NCC(C)(N)CCC(F)(F)F)n2c1 |
| InChI | InChI=1S/C23H24F6N4O2/c1-12-8-17(35-10-14-15(24)4-5-16(25)18(14)26)20-32-13(2)19(33(20)9-12)21(34)31-11-22(3,30)6-7-23(27,28)29/h4-5,8-9H,6-7,10-11,30H2,1-3H3,(H,31,34) |
| InChIKey | OZCNXQSBZSVKAE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|