About (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid
(Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid (PubChem CID 86725075) has the molecular formula C9H6Cl2O2S
and a molecular weight of 249.12 g/mol. Its IUPAC name is (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid |
| PubChem CID | 86725075 |
| Molecular Formula | C9H6Cl2O2S |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid |
| SMILES | O=C(O)/C(S)=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H6Cl2O2S/c10-6-2-1-3-7(11)5(6)4-8(14)9(12)13/h1-4,14H,(H,12,13)/b8-4- |
| InChIKey | OQAWURWKJZBNRX-YWEYNIOJSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid?
The IUPAC name of (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid (CID 86725075) is (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid.
What is the SMILES notation for (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid?
The canonical SMILES for (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid is O=C(O)/C(S)=C/c1c(Cl)cccc1Cl.
What is the InChIKey of (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid?
The InChIKey is OQAWURWKJZBNRX-YWEYNIOJSA-N. The full InChI is InChI=1S/C9H6Cl2O2S/c10-6-2-1-3-7(11)5(6)4-8(14)9(12)13/h1-4,14H,(H,12,13)/b8-4-.
What are the key properties of (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid?
(Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid has a molecular weight of 249.12 g/mol, XLogP of 3.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,6-dichlorophenyl)-2-sulfanylprop-2-enoic acid is sourced from PubChem (CID 86725075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).