C18H16ClN3O3 — CID 86725569
methyl 2-[5-[(3-chloro-4-methylphenyl)methoxy]pyrazol-1-yl]pyridine-4-carboxylate (PubChem CID 86725569) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is methyl 2-[5-[(3-chloro-4-methylphenyl)methoxy]pyrazol-1-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[5-[(3-chloro-4-methylphenyl)methoxy]pyrazol-1-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 86725569 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 2-[5-[(3-chloro-4-methylphenyl)methoxy]pyrazol-1-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(-n2nccc2OCc2ccc(C)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-12-3-4-13(9-15(12)19)11-25-17-6-8-21-22(17)16-10-14(5-7-20-16)18(23)24-2/h3-10H,11H2,1-2H3 |
| InChIKey | UQFZNSSFKBJHKE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |