About (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate
(2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate (PubChem CID 86726260) has the molecular formula C17H13N3O3S3
and a molecular weight of 403.51 g/mol. Its IUPAC name is (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate.
Molecular Properties
| Compound Name | (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate |
| PubChem CID | 86726260 |
| Molecular Formula | C17H13N3O3S3 |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate |
| SMILES | N#Cc1nc2ccc(OC(=O)OCCCSSc3ccccn3)cc2s1 |
| InChI | InChI=1S/C17H13N3O3S3/c18-11-16-20-13-6-5-12(10-14(13)25-16)23-17(21)22-8-3-9-24-26-15-4-1-2-7-19-15/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | AZQRGXKMAHVGIA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate?
The IUPAC name of (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate (CID 86726260) is (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate.
What is the SMILES notation for (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate?
The canonical SMILES for (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate is N#Cc1nc2ccc(OC(=O)OCCCSSc3ccccn3)cc2s1.
What is the InChIKey of (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate?
The InChIKey is AZQRGXKMAHVGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3S3/c18-11-16-20-13-6-5-12(10-14(13)25-16)23-17(21)22-8-3-9-24-26-15-4-1-2-7-19-15/h1-2,4-7,10H,3,8-9H2.
What are the key properties of (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate?
(2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate has a molecular weight of 403.51 g/mol, XLogP of 4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-1,3-benzothiazol-6-yl) 3-(pyridin-2-yldisulfanyl)propyl carbonate is sourced from PubChem (CID 86726260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).