C35H42N6O6 — CID 86726323
tert-butyl (2R,5R)-5-(azidomethyl)-2-[2-[2-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]phenyl]ethyl]morpholine-4-carboxylate (PubChem CID 86726323) has the molecular formula C35H42N6O6 and a molecular weight of 642.76 g/mol. Its IUPAC name is tert-butyl (2R,5R)-5-(azidomethyl)-2-[2-[2-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]phenyl]ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,5R)-5-(azidomethyl)-2-[2-[2-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]phenyl]ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 86726323 |
| Molecular Formula | C35H42N6O6 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | tert-butyl (2R,5R)-5-(azidomethyl)-2-[2-[2-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]phenyl]ethyl]morpholine-4-carboxylate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1ccccc1CC[C@@H]1CN(C(=O)OC(C)(C)C)[C@H](CN=[N+]=[N-])CO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42N6O6/c1-35(2,3)47-34(44)41-22-28(46-23-27(41)21-37-40-36)20-19-24-13-11-12-18-29(24)38-32(42)31(39-33(43)45-4)30(25-14-7-5-8-15-25)26-16-9-6-10-17-26/h5-18,27-28,30-31H,19-23H2,1-4H3,(H,38,42)(H,39,43)/t27-,28-,31+/m1/s1 |
| InChIKey | OCKLQKSRSXHHBT-WUNLWTINSA-N |
| XLogP | 6.43 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|