C30H36ClN7O3Si — CID 86726428
3-chloro-4-[[4-methoxy-5-(2-methyl-3H-benzimidazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide (PubChem CID 86726428) has the molecular formula C30H36ClN7O3Si and a molecular weight of 606.20 g/mol. Its IUPAC name is 3-chloro-4-[[4-methoxy-5-(2-methyl-3H-benzimidazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-chloro-4-[[4-methoxy-5-(2-methyl-3H-benzimidazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 86726428 |
| Molecular Formula | C30H36ClN7O3Si |
| Molecular Weight | 606.20 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 3-chloro-4-[[4-methoxy-5-(2-methyl-3H-benzimidazol-5-yl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-N,N-dimethylbenzamide |
| SMILES | COc1nc(Nc2ccc(C(=O)N(C)C)cc2Cl)nc2c1c(-c1ccc3nc(C)[nH]c3c1)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H36ClN7O3Si/c1-18-32-24-11-8-19(15-25(24)33-18)21-16-38(17-41-12-13-42(5,6)7)27-26(21)28(40-4)36-30(35-27)34-23-10-9-20(14-22(23)31)29(39)37(2)3/h8-11,14-16H,12-13,17H2,1-7H3,(H,32,33)(H,34,35,36) |
| InChIKey | AUVFPNGFZWMAIL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.20 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|