C32H43N7O3Si — CID 86726431
N,N,3-trimethyl-4-[[4-(oxan-4-ylamino)-5-pyridin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide (PubChem CID 86726431) has the molecular formula C32H43N7O3Si and a molecular weight of 601.83 g/mol. Its IUPAC name is N,N,3-trimethyl-4-[[4-(oxan-4-ylamino)-5-pyridin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N,N,3-trimethyl-4-[[4-(oxan-4-ylamino)-5-pyridin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 86726431 |
| Molecular Formula | C32H43N7O3Si |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | N,N,3-trimethyl-4-[[4-(oxan-4-ylamino)-5-pyridin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1cc(C(=O)N(C)C)ccc1Nc1nc(NC2CCOCC2)c2c(-c3ccncc3)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C32H43N7O3Si/c1-22-19-24(31(40)38(2)3)7-8-27(22)35-32-36-29(34-25-11-15-41-16-12-25)28-26(23-9-13-33-14-10-23)20-39(30(28)37-32)21-42-17-18-43(4,5)6/h7-10,13-14,19-20,25H,11-12,15-18,21H2,1-6H3,(H2,34,35,36,37) |
| InChIKey | ULXYPCFRAUTUCU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|