C22H32N4O4Si — CID 86726643
13-[4-(hydroxymethyl)cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 86726643) has the molecular formula C22H32N4O4Si and a molecular weight of 444.61 g/mol. Its IUPAC name is 13-[4-(hydroxymethyl)cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[4-(hydroxymethyl)cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 86726643 |
| Molecular Formula | C22H32N4O4Si |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 13-[4-(hydroxymethyl)cyclohexyl]-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1c(=O)[nH]c(=O)n(C3CCC(CO)CC3)c12 |
| InChI | InChI=1S/C22H32N4O4Si/c1-31(2,3)11-10-30-14-25-9-8-17-19-18(12-23-20(17)25)21(28)24-22(29)26(19)16-6-4-15(13-27)5-7-16/h8-9,12,15-16,27H,4-7,10-11,13-14H2,1-3H3,(H,24,28,29) |
| InChIKey | SOLXCKGNIYCUSR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|