C25H24F3N5O3 — CID 86726736
N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-2,3-dihydrofuro[2,3-b]pyridin-5-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 86726736) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-2,3-dihydrofuro[2,3-b]pyridin-5-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-2,3-dihydrofuro[2,3-b]pyridin-5-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 86726736 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[4-[(3R,4R,5S)-3-amino-4-hydroxy-5-methylpiperidin-1-yl]-2,3-dihydrofuro[2,3-b]pyridin-5-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1CN(c2c(NC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)cnc3c2CCO3)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C25H24F3N5O3/c1-12-10-33(11-17(29)23(12)34)22-13-7-8-36-25(13)30-9-19(22)32-24(35)18-6-5-16(28)21(31-18)20-14(26)3-2-4-15(20)27/h2-6,9,12,17,23,34H,7-8,10-11,29H2,1H3,(H,32,35)/t12-,17+,23+/m0/s1 |
| InChIKey | BXHUOGUHECQWGM-QHLKIINSSA-N |
| XLogP | 2.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |