C22H19Cl3F3NO3 — CID 86727016
tert-butyl 2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate (PubChem CID 86727016) has the molecular formula C22H19Cl3F3NO3 and a molecular weight of 508.75 g/mol. Its IUPAC name is tert-butyl 2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate.
| Compound Name | tert-butyl 2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 86727016 |
| Molecular Formula | C22H19Cl3F3NO3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | tert-butyl 2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate |
| SMILES | Cc1cc(C2=NO[C@@](c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H19Cl3F3NO3/c1-11-7-12(5-6-14(11)19(30)31-20(2,3)4)17-10-21(32-29-17,22(26,27)28)13-8-15(23)18(25)16(24)9-13/h5-9H,10H2,1-4H3/t21-/m0/s1 |
| InChIKey | CIPOVXBQTBKMAW-NRFANRHFSA-N |
| XLogP | 7.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|