About 2-(2,3,4-trifluorophenyl)-1,3-dioxolane
2-(2,3,4-trifluorophenyl)-1,3-dioxolane (PubChem CID 86727231) has the molecular formula C9H7F3O2
and a molecular weight of 204.15 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(2,3,4-trifluorophenyl)-1,3-dioxolane |
| PubChem CID | 86727231 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)-1,3-dioxolane |
| SMILES | Fc1ccc(C2OCCO2)c(F)c1F |
| InChI | InChI=1S/C9H7F3O2/c10-6-2-1-5(7(11)8(6)12)9-13-3-4-14-9/h1-2,9H,3-4H2 |
| InChIKey | HLLWNWWVODMCEP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,4-trifluorophenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,4-trifluorophenyl)-1,3-dioxolane?
The IUPAC name of 2-(2,3,4-trifluorophenyl)-1,3-dioxolane (CID 86727231) is 2-(2,3,4-trifluorophenyl)-1,3-dioxolane.
What is the SMILES notation for 2-(2,3,4-trifluorophenyl)-1,3-dioxolane?
The canonical SMILES for 2-(2,3,4-trifluorophenyl)-1,3-dioxolane is Fc1ccc(C2OCCO2)c(F)c1F.
What is the InChIKey of 2-(2,3,4-trifluorophenyl)-1,3-dioxolane?
The InChIKey is HLLWNWWVODMCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O2/c10-6-2-1-5(7(11)8(6)12)9-13-3-4-14-9/h1-2,9H,3-4H2.
What are the key properties of 2-(2,3,4-trifluorophenyl)-1,3-dioxolane?
2-(2,3,4-trifluorophenyl)-1,3-dioxolane has a molecular weight of 204.15 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4-trifluorophenyl)-1,3-dioxolane is sourced from PubChem (CID 86727231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).