C19H21F6N5O4 — CID 86727459
9-(azetidin-3-ylamino)-1-methyl-8-(1,1,1-trifluoropropan-2-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 86727459) has the molecular formula C19H21F6N5O4 and a molecular weight of 497.40 g/mol. Its IUPAC name is 9-(azetidin-3-ylamino)-1-methyl-8-(1,1,1-trifluoropropan-2-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-(azetidin-3-ylamino)-1-methyl-8-(1,1,1-trifluoropropan-2-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86727459 |
| Molecular Formula | C19H21F6N5O4 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 9-(azetidin-3-ylamino)-1-methyl-8-(1,1,1-trifluoropropan-2-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC1C(=O)NN=C2COc3cc(C(C)C(F)(F)F)c(NC4CNC4)cc3N21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20F3N5O2.C2HF3O2/c1-8(17(18,19)20)11-3-14-13(4-12(11)22-10-5-21-6-10)25-9(2)16(26)24-23-15(25)7-27-14;3-2(4,5)1(6)7/h3-4,8-10,21-22H,5-7H2,1-2H3,(H,24,26);(H,6,7) |
| InChIKey | YNOLJJILQPAVQK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|