C24H25F3N4O4 — CID 86727469
1-methyl-8-phenyl-9-piperidin-4-yl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 86727469) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is 1-methyl-8-phenyl-9-piperidin-4-yl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-8-phenyl-9-piperidin-4-yl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86727469 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-methyl-8-phenyl-9-piperidin-4-yl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC1C(=O)NN=C2COc3cc(-c4ccccc4)c(C4CCNCC4)cc3N21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O2.C2HF3O2/c1-14-22(27)25-24-21-13-28-20-12-18(15-5-3-2-4-6-15)17(11-19(20)26(14)21)16-7-9-23-10-8-16;3-2(4,5)1(6)7/h2-6,11-12,14,16,23H,7-10,13H2,1H3,(H,25,27);(H,6,7) |
| InChIKey | KEKIMCSITNTHRE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |