C23H25FN4O2 — CID 86727592
(1R)-8-(2-fluorophenyl)-1-methyl-9-(1-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 86727592) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is (1R)-8-(2-fluorophenyl)-1-methyl-9-(1-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-(1-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 86727592 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-(1-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | C[C@@H]1C(=O)NN=C2COc3cc(-c4ccccc4F)c(C4CCN(C)CC4)cc3N21 |
| InChI | InChI=1S/C23H25FN4O2/c1-14-23(29)26-25-22-13-30-21-12-18(16-5-3-4-6-19(16)24)17(11-20(21)28(14)22)15-7-9-27(2)10-8-15/h3-6,11-12,14-15H,7-10,13H2,1-2H3,(H,26,29)/t14-/m1/s1 |
| InChIKey | GABPILVYPFTQPJ-CQSZACIVSA-N |
| XLogP | 3.33 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |