C27H37NO6Si — CID 86727733
(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (PubChem CID 86727733) has the molecular formula C27H37NO6Si and a molecular weight of 499.68 g/mol. Its IUPAC name is (2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid.
| Compound Name | (2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 86727733 |
| Molecular Formula | C27H37NO6Si |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C(=O)O)OC[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H37NO6Si/c1-26(2,3)34-25(31)28-17-23(24(29)30)32-18-20(28)19-33-35(27(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23H,17-19H2,1-6H3,(H,29,30)/t20-,23-/m1/s1 |
| InChIKey | GNUMQSSZFHBAMA-NFBKMPQASA-N |
| XLogP | 3.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|