About methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate
methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate (PubChem CID 86727955) has the molecular formula C36H38N6O3
and a molecular weight of 602.74 g/mol. Its IUPAC name is methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate |
| PubChem CID | 86727955 |
| Molecular Formula | C36H38N6O3 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate |
| SMILES | COC(=O)CCc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C36H38N6O3/c1-45-35(43)15-14-28-20-29(22-41(24-31-10-2-6-16-37-31)25-32-11-3-7-17-38-32)36(44)30(21-28)23-42(26-33-12-4-8-18-39-33)27-34-13-5-9-19-40-34/h2-13,16-21,44H,14-15,22-27H2,1H3 |
| InChIKey | XNUYQSHNSYLKSQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate?
The IUPAC name of methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate (CID 86727955) is methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate.
What is the SMILES notation for methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate?
The canonical SMILES for methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate is COC(=O)CCc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1.
What is the InChIKey of methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate?
The InChIKey is XNUYQSHNSYLKSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H38N6O3/c1-45-35(43)15-14-28-20-29(22-41(24-31-10-2-6-16-37-31)25-32-11-3-7-17-38-32)36(44)30(21-28)23-42(26-33-12-4-8-18-39-33)27-34-13-5-9-19-40-34/h2-13,16-21,44H,14-15,22-27H2,1H3.
What are the key properties of methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate?
methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate has a molecular weight of 602.74 g/mol, XLogP of 5.48, 15 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoate is sourced from PubChem (CID 86727955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).