About 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid
3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 86727956) has the molecular formula C35H36N6O3
and a molecular weight of 588.71 g/mol. Its IUPAC name is 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid |
| PubChem CID | 86727956 |
| Molecular Formula | C35H36N6O3 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C35H36N6O3/c42-34(43)14-13-27-19-28(21-40(23-30-9-1-5-15-36-30)24-31-10-2-6-16-37-31)35(44)29(20-27)22-41(25-32-11-3-7-17-38-32)26-33-12-4-8-18-39-33/h1-12,15-20,44H,13-14,21-26H2,(H,42,43) |
| InChIKey | GCFRUDKYUPOEDE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid?
The IUPAC name of 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid (CID 86727956) is 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid.
What is the SMILES notation for 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid?
The canonical SMILES for 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid is O=C(O)CCc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1.
What is the InChIKey of 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid?
The InChIKey is GCFRUDKYUPOEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H36N6O3/c42-34(43)14-13-27-19-28(21-40(23-30-9-1-5-15-36-30)24-31-10-2-6-16-37-31)35(44)29(20-27)22-41(25-32-11-3-7-17-38-32)26-33-12-4-8-18-39-33/h1-12,15-20,44H,13-14,21-26H2,(H,42,43).
What are the key properties of 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid?
3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid has a molecular weight of 588.71 g/mol, XLogP of 5.39, 15 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]propanoic acid is sourced from PubChem (CID 86727956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).