C24H22FNO2S — CID 86728085
4-fluoro-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide (PubChem CID 86728085) has the molecular formula C24H22FNO2S and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86728085 |
| Molecular Formula | C24H22FNO2S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-fluoro-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC=C1c2ccccc2CCc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FNO2S/c25-20-13-15-21(16-14-20)29(27,28)26-17-5-10-24-22-8-3-1-6-18(22)11-12-19-7-2-4-9-23(19)24/h1-4,6-10,13-16,26H,5,11-12,17H2 |
| InChIKey | UYBQWVKZAABVSG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|