C19H13ClFN3O — CID 86728232
2-(6-chloro-3-phenylmethoxy-2-pyridinyl)-4-fluoro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 86728232) has the molecular formula C19H13ClFN3O and a molecular weight of 353.78 g/mol. Its IUPAC name is 2-(6-chloro-3-phenylmethoxy-2-pyridinyl)-4-fluoro-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 2-(6-chloro-3-phenylmethoxy-2-pyridinyl)-4-fluoro-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 86728232 |
| Molecular Formula | C19H13ClFN3O |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-(6-chloro-3-phenylmethoxy-2-pyridinyl)-4-fluoro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | Fc1cncc2[nH]c(-c3nc(Cl)ccc3OCc3ccccc3)cc12 |
| InChI | InChI=1S/C19H13ClFN3O/c20-18-7-6-17(25-11-12-4-2-1-3-5-12)19(24-18)15-8-13-14(21)9-22-10-16(13)23-15/h1-10,23H,11H2 |
| InChIKey | LRUYBFHHPVTSBH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|