About 1-tert-butylimino-3,3-dimethylbutan-2-one
1-tert-butylimino-3,3-dimethylbutan-2-one (PubChem CID 86729170) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-tert-butylimino-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-tert-butylimino-3,3-dimethylbutan-2-one |
| PubChem CID | 86729170 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-tert-butylimino-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)/N=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-9(2,3)8(12)7-11-10(4,5)6/h7H,1-6H3/b11-7+ |
| InChIKey | WTQMPNHQSGDBTA-YRNVUSSQSA-N |
| XLogP | 2.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylimino-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylimino-3,3-dimethylbutan-2-one?
The IUPAC name of 1-tert-butylimino-3,3-dimethylbutan-2-one (CID 86729170) is 1-tert-butylimino-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-tert-butylimino-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-tert-butylimino-3,3-dimethylbutan-2-one is CC(C)(C)/N=C/C(=O)C(C)(C)C.
What is the InChIKey of 1-tert-butylimino-3,3-dimethylbutan-2-one?
The InChIKey is WTQMPNHQSGDBTA-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2,3)8(12)7-11-10(4,5)6/h7H,1-6H3/b11-7+.
What are the key properties of 1-tert-butylimino-3,3-dimethylbutan-2-one?
1-tert-butylimino-3,3-dimethylbutan-2-one has a molecular weight of 169.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylimino-3,3-dimethylbutan-2-one is sourced from PubChem (CID 86729170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).