C24H29N3O4 — CID 86729180
2-[[5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3-pyridinyl]methoxy]isoindole-1,3-dione (PubChem CID 86729180) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[[5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3-pyridinyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3-pyridinyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86729180 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[[5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3-pyridinyl]methoxy]isoindole-1,3-dione |
| SMILES | CC1(C)CCCC(C)(C)N1OCc1cncc(CON2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H29N3O4/c1-23(2)10-7-11-24(3,4)27(23)31-16-18-12-17(13-25-14-18)15-30-26-21(28)19-8-5-6-9-20(19)22(26)29/h5-6,8-9,12-14H,7,10-11,15-16H2,1-4H3 |
| InChIKey | RASVSXXRTAPHRB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|