C20H27BrF6N4O2Si — CID 86729598
6-bromo-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-3-amine (PubChem CID 86729598) has the molecular formula C20H27BrF6N4O2Si and a molecular weight of 577.44 g/mol. Its IUPAC name is 6-bromo-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-3-amine.
| Compound Name | 6-bromo-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 86729598 |
| Molecular Formula | C20H27BrF6N4O2Si |
| Molecular Weight | 577.44 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 6-bromo-5-(trifluoromethyl)-2-[5-[1,1,1-trifluoro-2-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-3-amine |
| SMILES | CC(C)[Si](OC(C)(c1nnc(-c2nc(Br)c(C(F)(F)F)cc2N)o1)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H27BrF6N4O2Si/c1-9(2)34(10(3)4,11(5)6)33-18(7,20(25,26)27)17-31-30-16(32-17)14-13(28)8-12(15(21)29-14)19(22,23)24/h8-11H,28H2,1-7H3 |
| InChIKey | RVFNVTAXGHEGHT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.44 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|