C17H18N2O — CID 86729837
N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-3-methylbenzamide (PubChem CID 86729837) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 86729837 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc([C@@H]3C[C@H]3N)cc2)c1 |
| InChI | InChI=1S/C17H18N2O/c1-11-3-2-4-13(9-11)17(20)19-14-7-5-12(6-8-14)15-10-16(15)18/h2-9,15-16H,10,18H2,1H3,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | LJNXDARUPZPSJU-JKSUJKDBSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |