About disodium;3-hydroxynaphthalene-2,7-disulfonate
disodium;3-hydroxynaphthalene-2,7-disulfonate (PubChem CID 8673) has the molecular formula C10H6Na2O7S2
and a molecular weight of 348.27 g/mol. Its IUPAC name is disodium;3-hydroxynaphthalene-2,7-disulfonate.
Molecular Properties
| Compound Name | disodium;3-hydroxynaphthalene-2,7-disulfonate |
| PubChem CID | 8673 |
| Molecular Formula | C10H6Na2O7S2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | disodium;3-hydroxynaphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cc(O)c(S(=O)(=O)[O-])cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H8O7S2.2Na/c11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17;;/h1-5,11H,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | VNEBWJSWMVTSHK-UHFFFAOYSA-L |
| XLogP | -5.64 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-hydroxynaphthalene-2,7-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-hydroxynaphthalene-2,7-disulfonate?
The IUPAC name of disodium;3-hydroxynaphthalene-2,7-disulfonate (CID 8673) is disodium;3-hydroxynaphthalene-2,7-disulfonate.
What is the SMILES notation for disodium;3-hydroxynaphthalene-2,7-disulfonate?
The canonical SMILES for disodium;3-hydroxynaphthalene-2,7-disulfonate is O=S(=O)([O-])c1ccc2cc(O)c(S(=O)(=O)[O-])cc2c1.[Na+].[Na+].
What is the InChIKey of disodium;3-hydroxynaphthalene-2,7-disulfonate?
The InChIKey is VNEBWJSWMVTSHK-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O7S2.2Na/c11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17;;/h1-5,11H,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2.
What are the key properties of disodium;3-hydroxynaphthalene-2,7-disulfonate?
disodium;3-hydroxynaphthalene-2,7-disulfonate has a molecular weight of 348.27 g/mol, XLogP of -5.64, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-hydroxynaphthalene-2,7-disulfonate is sourced from PubChem (CID 8673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).