C27H43NO3 — CID 86730051
tert-butyl N-[(1R,3S)-3-[(6R)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]-1-(hydroxymethyl)cyclopentyl]carbamate (PubChem CID 86730051) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[(6R)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]-1-(hydroxymethyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[(6R)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]-1-(hydroxymethyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 86730051 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[(6R)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]-1-(hydroxymethyl)cyclopentyl]carbamate |
| SMILES | CCCCCC[C@@H]1CCc2cc([C@H]3CC[C@@](CO)(NC(=O)OC(C)(C)C)C3)ccc2C1 |
| InChI | InChI=1S/C27H43NO3/c1-5-6-7-8-9-20-10-11-22-17-23(13-12-21(22)16-20)24-14-15-27(18-24,19-29)28-25(30)31-26(2,3)4/h12-13,17,20,24,29H,5-11,14-16,18-19H2,1-4H3,(H,28,30)/t20-,24+,27-/m1/s1 |
| InChIKey | QOGUTPAJFDLMSW-WMVAVLGLSA-N |
| XLogP | 6.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|