C27H31N5O2 — CID 86730246
(4S)-4-methyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 86730246) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (4S)-4-methyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-methyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86730246 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (4S)-4-methyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CC(Nc1nccc(N2C(=O)OC[C@]2(C)c2ccccc2)n1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-20(21-11-13-23(14-12-21)31-17-7-4-8-18-31)29-25-28-16-15-24(30-25)32-26(33)34-19-27(32,2)22-9-5-3-6-10-22/h3,5-6,9-16,20H,4,7-8,17-19H2,1-2H3,(H,28,29,30)/t20?,27-/m1/s1 |
| InChIKey | YVODIRDFZUWKBG-MQBBKVSDSA-N |
| XLogP | 5.51 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|