C14H14BrNOS — CID 86730711
2-(bromomethyl)-9-methoxy-2,3-dihydro-1H-thiopyrano[2,3-c]quinoline (PubChem CID 86730711) has the molecular formula C14H14BrNOS and a molecular weight of 324.24 g/mol. Its IUPAC name is 2-(bromomethyl)-9-methoxy-2,3-dihydro-1H-thiopyrano[2,3-c]quinoline.
| Compound Name | 2-(bromomethyl)-9-methoxy-2,3-dihydro-1H-thiopyrano[2,3-c]quinoline |
|---|---|
| PubChem CID | 86730711 |
| Molecular Formula | C14H14BrNOS |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-(bromomethyl)-9-methoxy-2,3-dihydro-1H-thiopyrano[2,3-c]quinoline |
| SMILES | COc1ccc2ncc3c(c2c1)CC(CBr)CS3 |
| InChI | InChI=1S/C14H14BrNOS/c1-17-10-2-3-13-11(5-10)12-4-9(6-15)8-18-14(12)7-16-13/h2-3,5,7,9H,4,6,8H2,1H3 |
| InChIKey | JPDALWCNEFXJLV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|