C14H11Cl2N5O2S — CID 86730816
1-[4-(benzenesulfonyl)-3,5-dichlorophenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 86730816) has the molecular formula C14H11Cl2N5O2S and a molecular weight of 384.25 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-3,5-dichlorophenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[4-(benzenesulfonyl)-3,5-dichlorophenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 86730816 |
| Molecular Formula | C14H11Cl2N5O2S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-3,5-dichlorophenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2cc(Cl)c(S(=O)(=O)c3ccccc3)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H11Cl2N5O2S/c15-10-6-8(21-14(18)19-13(17)20-21)7-11(16)12(10)24(22,23)9-4-2-1-3-5-9/h1-7H,(H4,17,18,19,20) |
| InChIKey | QQJWLNQCWVWRGF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |