About 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine
6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (PubChem CID 86730943) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
| PubChem CID | 86730943 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
| SMILES | C=Cc1ccc2c(n1)OCCO2 |
| InChI | InChI=1S/C9H9NO2/c1-2-7-3-4-8-9(10-7)12-6-5-11-8/h2-4H,1,5-6H2 |
| InChIKey | MWPPNLCKDBOQKL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The IUPAC name of 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (CID 86730943) is 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
What is the SMILES notation for 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The canonical SMILES for 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is C=Cc1ccc2c(n1)OCCO2.
What is the InChIKey of 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The InChIKey is MWPPNLCKDBOQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-7-3-4-8-9(10-7)12-6-5-11-8/h2-4H,1,5-6H2.
What are the key properties of 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine has a molecular weight of 163.18 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is sourced from PubChem (CID 86730943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).