About N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide
N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide (PubChem CID 867319) has the molecular formula C13H10ClNO3
and a molecular weight of 263.68 g/mol. Its IUPAC name is N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide |
| PubChem CID | 867319 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)C1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10ClNO3/c1-7(16)15(2)11-10(14)12(17)8-5-3-4-6-9(8)13(11)18/h3-6H,1-2H3 |
| InChIKey | XRCKNQISJJIMQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide?
The IUPAC name of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide (CID 867319) is N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide.
What is the SMILES notation for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide?
The canonical SMILES for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide is CC(=O)N(C)C1=C(Cl)C(=O)c2ccccc2C1=O.
What is the InChIKey of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide?
The InChIKey is XRCKNQISJJIMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO3/c1-7(16)15(2)11-10(14)12(17)8-5-3-4-6-9(8)13(11)18/h3-6H,1-2H3.
What are the key properties of N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide?
N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide has a molecular weight of 263.68 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-1,4-dioxonaphthalen-2-yl)-N-methylacetamide is sourced from PubChem (CID 867319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).