C37H34N2O11S — CID 86731963
(2R,3R)-2,3-dibenzoyloxybutanedioic acid;5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 86731963) has the molecular formula C37H34N2O11S and a molecular weight of 714.75 g/mol. Its IUPAC name is (2R,3R)-2,3-dibenzoyloxybutanedioic acid;5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (2R,3R)-2,3-dibenzoyloxybutanedioic acid;5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86731963 |
| Molecular Formula | C37H34N2O11S |
| Molecular Weight | 714.75 g/mol |
| Exact Mass | 714.19 |
| IUPAC Name | (2R,3R)-2,3-dibenzoyloxybutanedioic acid;5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1.O=C(O[C@@H](C(=O)O)[C@@H](OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3S.C18H14O8/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17;19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23);1-10,13-14H,(H,19,20)(H,21,22)/t;13-,14-/m.1/s1 |
| InChIKey | SHJAOBHAPLGWMY-YOAVLPSOSA-N |
| XLogP | 4.77 |
| TPSA | 195.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|