C24H23F9O6S — CID 86732091
[(8S,9S,11R,13S,14S)-13-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 86732091) has the molecular formula C24H23F9O6S and a molecular weight of 610.49 g/mol. Its IUPAC name is [(8S,9S,11R,13S,14S)-13-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(8S,9S,11R,13S,14S)-13-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 86732091 |
| Molecular Formula | C24H23F9O6S |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | [(8S,9S,11R,13S,14S)-13-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)C(=O)CC[C@H]2[C@@H]2CCc3cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc3[C@H]21 |
| InChI | InChI=1S/C24H23F9O6S/c1-11(34)38-17-10-20(2)16(7-8-18(20)35)15-5-3-12-9-13(4-6-14(12)19(15)17)39-40(36,37)24(32,33)22(27,28)21(25,26)23(29,30)31/h4,6,9,15-17,19H,3,5,7-8,10H2,1-2H3/t15-,16-,17+,19+,20-/m0/s1 |
| InChIKey | QLDBUQNVMMDFPV-OIGVQNGMSA-N |
| XLogP | 5.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|