C25H25F2NO2 — CID 86732096
methyl (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 86732096) has the molecular formula C25H25F2NO2 and a molecular weight of 409.48 g/mol. Its IUPAC name is methyl (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 86732096 |
| Molecular Formula | C25H25F2NO2 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methyl (8S,9S,11S,13S,14S)-11-fluoro-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC[C@@H]1[C@@H]2[C@@H](F)C[C@]2(C)C(c3cncc(F)c3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H25F2NO2/c1-25-11-22(27)23-18-5-4-15(24(29)30-2)9-14(18)3-6-19(23)21(25)8-7-20(25)16-10-17(26)13-28-12-16/h4-5,7,9-10,12-13,19,21-23H,3,6,8,11H2,1-2H3/t19-,21-,22-,23+,25+/m0/s1 |
| InChIKey | GONPKVGMLIEUJD-JJVSTHJESA-N |
| XLogP | 5.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |