C20H17F5N6O2 — CID 86732247
(4S,6S)-4-[2,3-difluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 86732247) has the molecular formula C20H17F5N6O2 and a molecular weight of 468.39 g/mol. Its IUPAC name is (4S,6S)-4-[2,3-difluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4S,6S)-4-[2,3-difluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 86732247 |
| Molecular Formula | C20H17F5N6O2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (4S,6S)-4-[2,3-difluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | COc1cnc2c(Nc3cc(F)c(F)c([C@]4(C)C[C@@H](C(F)(F)F)OC(N)=N4)c3)nccc2n1 |
| InChI | InChI=1S/C20H17F5N6O2/c1-19(7-13(20(23,24)25)33-18(26)31-19)10-5-9(6-11(21)15(10)22)29-17-16-12(3-4-27-17)30-14(32-2)8-28-16/h3-6,8,13H,7H2,1-2H3,(H2,26,31)(H,27,29)/t13-,19-/m0/s1 |
| InChIKey | BAGSELRCANBMKO-DJJJIMSYSA-N |
| XLogP | 3.94 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |