About 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine
7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 86732277) has the molecular formula C6H2ClF2N3S
and a molecular weight of 221.62 g/mol. Its IUPAC name is 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 86732277 |
| Molecular Formula | C6H2ClF2N3S |
| Molecular Weight | 221.62 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | FC(F)c1nc2c(Cl)ncnc2s1 |
| InChI | InChI=1S/C6H2ClF2N3S/c7-3-2-5(11-1-10-3)13-6(12-2)4(8)9/h1,4H |
| InChIKey | IHQNDGGDVOEBFB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine (CID 86732277) is 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine is FC(F)c1nc2c(Cl)ncnc2s1.
What is the InChIKey of 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is IHQNDGGDVOEBFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF2N3S/c7-3-2-5(11-1-10-3)13-6(12-2)4(8)9/h1,4H.
What are the key properties of 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine?
7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 221.62 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 86732277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).