C20H22N2O4S — CID 86732338
tert-butyl N-(benzenesulfonylmethyl)-N-(4-cyano-2-methylphenyl)carbamate (PubChem CID 86732338) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonylmethyl)-N-(4-cyano-2-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(benzenesulfonylmethyl)-N-(4-cyano-2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 86732338 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | tert-butyl N-(benzenesulfonylmethyl)-N-(4-cyano-2-methylphenyl)carbamate |
| SMILES | Cc1cc(C#N)ccc1N(CS(=O)(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22N2O4S/c1-15-12-16(13-21)10-11-18(15)22(19(23)26-20(2,3)4)14-27(24,25)17-8-6-5-7-9-17/h5-12H,14H2,1-4H3 |
| InChIKey | IUKCTVWCPCCOLR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |