C29H26Cl2N6O3 — CID 86732554
1,3-bis[[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]methyl]urea (PubChem CID 86732554) has the molecular formula C29H26Cl2N6O3 and a molecular weight of 577.47 g/mol. Its IUPAC name is 1,3-bis[[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]methyl]urea.
| Compound Name | 1,3-bis[[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 86732554 |
| Molecular Formula | C29H26Cl2N6O3 |
| Molecular Weight | 577.47 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 1,3-bis[[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]methyl]urea |
| SMILES | O=C(NCC1CNC(=O)c2cc(-c3cccc(Cl)c3)cn21)NCC1CNC(=O)c2cc(-c3cccc(Cl)c3)cn21 |
| InChI | InChI=1S/C29H26Cl2N6O3/c30-21-5-1-3-17(7-21)19-9-25-27(38)32-11-23(36(25)15-19)13-34-29(40)35-14-24-12-33-28(39)26-10-20(16-37(24)26)18-4-2-6-22(31)8-18/h1-10,15-16,23-24H,11-14H2,(H,32,38)(H,33,39)(H2,34,35,40) |
| InChIKey | CSGDDXRQHYROPT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |