C17H18ClN3O5S — CID 86732914
(2S,5R,6R)-6-[[2-(2-chlorophenyl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 86732914) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is (2S,5R,6R)-6-[[2-(2-chlorophenyl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[[2-(2-chlorophenyl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 86732914 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (2S,5R,6R)-6-[[2-(2-chlorophenyl)-2-methoxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O5S/c1-17(2)12(16(24)25)21-14(23)11(15(21)27-17)19-13(22)10(20-26-3)8-6-4-5-7-9(8)18/h4-7,11-12,15H,1-3H3,(H,19,22)(H,24,25)/t11-,12+,15-/m1/s1 |
| InChIKey | VOBIEIUJWIJOKX-TYNCELHUSA-N |
| XLogP | 1.32 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|