C19H19N3S — CID 86733422
(8,9,10,12-tetrahydro-7H-tetracen-5-ylideneamino)thiourea (PubChem CID 86733422) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is (8,9,10,12-tetrahydro-7H-tetracen-5-ylideneamino)thiourea.
| Compound Name | (8,9,10,12-tetrahydro-7H-tetracen-5-ylideneamino)thiourea |
|---|---|
| PubChem CID | 86733422 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (8,9,10,12-tetrahydro-7H-tetracen-5-ylideneamino)thiourea |
| SMILES | NC(=S)NN=C1c2ccccc2Cc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C19H19N3S/c20-19(23)22-21-18-16-8-4-3-7-14(16)10-15-9-12-5-1-2-6-13(12)11-17(15)18/h3-4,7-9,11H,1-2,5-6,10H2,(H3,20,22,23) |
| InChIKey | HCPFAQOMPNRUIO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|