C17H22N2O6S — CID 8673349
ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-[(E)-pent-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 8673349) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-[(E)-pent-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-[(E)-pent-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8673349 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-[(E)-pent-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CC/C=C/C(=O)OCC(=O)Nc1sc(C(=O)NC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C17H22N2O6S/c1-5-7-8-12(21)25-9-11(20)19-16-13(17(23)24-6-2)10(3)14(26-16)15(22)18-4/h7-8H,5-6,9H2,1-4H3,(H,18,22)(H,19,20)/b8-7+ |
| InChIKey | QKOYPBRWGROZNU-BQYQJAHWSA-N |
| XLogP | 2.04 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|