About 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol
2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol (PubChem CID 86733594) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol.
Molecular Properties
| Compound Name | 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol |
| PubChem CID | 86733594 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.OCCOCCO |
| InChI | InChI=1S/C9H6N2O2.C4H10O3/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;5-1-3-7-4-2-6/h2-4H,1H3;5-6H,1-4H2 |
| InChIKey | CCMKNYLYGDAFID-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol?
The IUPAC name of 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol (CID 86733594) is 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol.
What is the SMILES notation for 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol?
The canonical SMILES for 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol is Cc1ccc(N=C=O)cc1N=C=O.OCCOCCO.
What is the InChIKey of 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol?
The InChIKey is CCMKNYLYGDAFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.C4H10O3/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;5-1-3-7-4-2-6/h2-4H,1H3;5-6H,1-4H2.
What are the key properties of 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol?
2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol has a molecular weight of 280.28 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanato-1-methylbenzene;2-(2-hydroxyethoxy)ethanol is sourced from PubChem (CID 86733594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).