About 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione
9-ethenylcarbazole;2-ethenylisoindole-1,3-dione (PubChem CID 86733704) has the molecular formula C24H18N2O2
and a molecular weight of 366.42 g/mol. Its IUPAC name is 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione |
| PubChem CID | 86733704 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione |
| SMILES | C=CN1C(=O)c2ccccc2C1=O.C=Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C14H11N.C10H7NO2/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h2-10H,1H2;2-6H,1H2 |
| InChIKey | MXRLTZZPAGWCGY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione?
The IUPAC name of 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione (CID 86733704) is 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione.
What is the SMILES notation for 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione?
The canonical SMILES for 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione is C=CN1C(=O)c2ccccc2C1=O.C=Cn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione?
The InChIKey is MXRLTZZPAGWCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C10H7NO2/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h2-10H,1H2;2-6H,1H2.
What are the key properties of 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione?
9-ethenylcarbazole;2-ethenylisoindole-1,3-dione has a molecular weight of 366.42 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylcarbazole;2-ethenylisoindole-1,3-dione is sourced from PubChem (CID 86733704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).