(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid

C15H24O2 — CID 86733722

IUPAC(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid
SMILESCC(C)=CCCC(C)C/C=C\C(C)=CC(=O)O
InChIInChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h6-7,10-11,13H,5,8-9H2,1-4H3,(H,16,17)/b10-6-,14-11?
InChIKeyPJXNSLRVBKVDHN-JNWROIKISA-N
MW236.35 g/mol
LogP4.35
Rot. Bonds7

About (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid

(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid (PubChem CID 86733722) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid.

Molecular Properties

Compound Name(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid
PubChem CID86733722
Molecular FormulaC15H24O2
Molecular Weight236.35 g/mol
Exact Mass236.18
IUPAC Name(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid
SMILESCC(C)=CCCC(C)C/C=C\C(C)=CC(=O)O
InChIInChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h6-7,10-11,13H,5,8-9H2,1-4H3,(H,16,17)/b10-6-,14-11?
InChIKeyPJXNSLRVBKVDHN-JNWROIKISA-N
XLogP4.35
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.35
LogP ≤ 54.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid?
The IUPAC name of (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid (CID 86733722) is (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid.
What is the SMILES notation for (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid?
The canonical SMILES for (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid is CC(C)=CCCC(C)C/C=C\C(C)=CC(=O)O.
What is the InChIKey of (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid?
The InChIKey is PJXNSLRVBKVDHN-JNWROIKISA-N. The full InChI is InChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h6-7,10-11,13H,5,8-9H2,1-4H3,(H,16,17)/b10-6-,14-11?.
What are the key properties of (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid?
(4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid has a molecular weight of 236.35 g/mol, XLogP of 4.35, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3,7,11-trimethyldodeca-2,4,10-trienoic acid is sourced from PubChem (CID 86733722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).