About 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid
4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid (PubChem CID 86734074) has the molecular formula C10H11NO2S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid |
| PubChem CID | 86734074 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid |
| SMILES | Cc1ncsc1C.O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H7NS.C5H4O2S/c1-4-5(2)7-3-6-4;6-5(7)4-2-1-3-8-4/h3H,1-2H3;1-3H,(H,6,7) |
| InChIKey | VAOOEKONVPCDCS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid?
The IUPAC name of 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid (CID 86734074) is 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid.
What is the SMILES notation for 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid?
The canonical SMILES for 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid is Cc1ncsc1C.O=C(O)c1cccs1.
What is the InChIKey of 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid?
The InChIKey is VAOOEKONVPCDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS.C5H4O2S/c1-4-5(2)7-3-6-4;6-5(7)4-2-1-3-8-4/h3H,1-2H3;1-3H,(H,6,7).
What are the key properties of 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid?
4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid has a molecular weight of 241.34 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-thiazole;thiophene-2-carboxylic acid is sourced from PubChem (CID 86734074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).