C20H24N4O5 — CID 8673417
[2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-ethylamino]-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673417) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-ethylamino]-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-ethylamino]-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673417 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-ethylamino]-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)N(CC)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N4O5/c1-3-5-11-16(26)29-13-15(25)23(4-2)17-18(21)24(20(28)22-19(17)27)12-14-9-7-6-8-10-14/h5-11H,3-4,12-13,21H2,1-2H3,(H,22,27,28)/b11-5+ |
| InChIKey | NHADPQKLJPGYJG-VZUCSPMQSA-N |
| XLogP | 1.03 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|