C11H16O4 — CID 86734209
5,5-bis(hydroxymethyl)nona-1,3,6,8-tetraene-4,6-diol (PubChem CID 86734209) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5,5-bis(hydroxymethyl)nona-1,3,6,8-tetraene-4,6-diol.
| Compound Name | 5,5-bis(hydroxymethyl)nona-1,3,6,8-tetraene-4,6-diol |
|---|---|
| PubChem CID | 86734209 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5,5-bis(hydroxymethyl)nona-1,3,6,8-tetraene-4,6-diol |
| SMILES | C=CC=C(O)C(CO)(CO)C(O)=CC=C |
| InChI | InChI=1S/C11H16O4/c1-3-5-9(14)11(7-12,8-13)10(15)6-4-2/h3-6,12-15H,1-2,7-8H2 |
| InChIKey | AZZDPFVTPYUQNK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|