About (Z)-8-methoxy-3,7-dimethyloct-6-enal
(Z)-8-methoxy-3,7-dimethyloct-6-enal (PubChem CID 86734392) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (Z)-8-methoxy-3,7-dimethyloct-6-enal.
Molecular Properties
| Compound Name | (Z)-8-methoxy-3,7-dimethyloct-6-enal |
| PubChem CID | 86734392 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (Z)-8-methoxy-3,7-dimethyloct-6-enal |
| SMILES | COC/C(C)=C\CCC(C)CC=O |
| InChI | InChI=1S/C11H20O2/c1-10(7-8-12)5-4-6-11(2)9-13-3/h6,8,10H,4-5,7,9H2,1-3H3/b11-6- |
| InChIKey | XFQGFZNLVDBYKY-WDZFZDKYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-8-methoxy-3,7-dimethyloct-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-8-methoxy-3,7-dimethyloct-6-enal?
The IUPAC name of (Z)-8-methoxy-3,7-dimethyloct-6-enal (CID 86734392) is (Z)-8-methoxy-3,7-dimethyloct-6-enal.
What is the SMILES notation for (Z)-8-methoxy-3,7-dimethyloct-6-enal?
The canonical SMILES for (Z)-8-methoxy-3,7-dimethyloct-6-enal is COC/C(C)=C\CCC(C)CC=O.
What is the InChIKey of (Z)-8-methoxy-3,7-dimethyloct-6-enal?
The InChIKey is XFQGFZNLVDBYKY-WDZFZDKYSA-N. The full InChI is InChI=1S/C11H20O2/c1-10(7-8-12)5-4-6-11(2)9-13-3/h6,8,10H,4-5,7,9H2,1-3H3/b11-6-.
What are the key properties of (Z)-8-methoxy-3,7-dimethyloct-6-enal?
(Z)-8-methoxy-3,7-dimethyloct-6-enal has a molecular weight of 184.28 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-8-methoxy-3,7-dimethyloct-6-enal is sourced from PubChem (CID 86734392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).