C28H24ClN5O3 — CID 86734568
N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-3-(1,3-dioxoisoindol-2-yl)pentanehydrazide (PubChem CID 86734568) has the molecular formula C28H24ClN5O3 and a molecular weight of 513.99 g/mol. Its IUPAC name is N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-3-(1,3-dioxoisoindol-2-yl)pentanehydrazide.
| Compound Name | N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-3-(1,3-dioxoisoindol-2-yl)pentanehydrazide |
|---|---|
| PubChem CID | 86734568 |
| Molecular Formula | C28H24ClN5O3 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-3-(1,3-dioxoisoindol-2-yl)pentanehydrazide |
| SMILES | CCC(CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H24ClN5O3/c1-2-19(34-27(36)20-10-6-7-11-21(20)28(34)37)15-25(35)33-32-24-16-30-26(17-8-4-3-5-9-17)22-14-18(29)12-13-23(22)31-24/h3-14,19H,2,15-16H2,1H3,(H,31,32)(H,33,35) |
| InChIKey | SHEDDRHOTSXZPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|