C17H14N4O3S — CID 86734656
4,5-dimethyl-8-oxido-7-phenyl-3-thia-1,11,13-triaza-8-azoniatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid (PubChem CID 86734656) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4,5-dimethyl-8-oxido-7-phenyl-3-thia-1,11,13-triaza-8-azoniatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid.
| Compound Name | 4,5-dimethyl-8-oxido-7-phenyl-3-thia-1,11,13-triaza-8-azoniatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid |
|---|---|
| PubChem CID | 86734656 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4,5-dimethyl-8-oxido-7-phenyl-3-thia-1,11,13-triaza-8-azoniatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene-12-carboxylic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccccc1)=[N+]([O-])Cc1nc(C(=O)O)nn1-2 |
| InChI | InChI=1S/C17H14N4O3S/c1-9-10(2)25-16-13(9)14(11-6-4-3-5-7-11)20(24)8-12-18-15(17(22)23)19-21(12)16/h3-7H,8H2,1-2H3,(H,22,23) |
| InChIKey | WMSRFCZEAQGCTM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|